C18H16BrIN2O4 — CID 98334382
1-[(2S)-2-(5-bromo-2,4-dimethoxyphenyl)-5-(3-iodophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone (PubChem CID 98334382) has the molecular formula C18H16BrIN2O4 and a molecular weight of 531.14 g/mol. Its IUPAC name is 1-[(2S)-2-(5-bromo-2,4-dimethoxyphenyl)-5-(3-iodophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone.
| Compound Name | 1-[(2S)-2-(5-bromo-2,4-dimethoxyphenyl)-5-(3-iodophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 98334382 |
| Molecular Formula | C18H16BrIN2O4 |
| Molecular Weight | 531.14 g/mol |
| Exact Mass | 529.93 |
| IUPAC Name | 1-[(2S)-2-(5-bromo-2,4-dimethoxyphenyl)-5-(3-iodophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
| SMILES | COc1cc(OC)c([C@@H]2OC(c3cccc(I)c3)=NN2C(C)=O)cc1Br |
| InChI | InChI=1S/C18H16BrIN2O4/c1-10(23)22-18(13-8-14(19)16(25-3)9-15(13)24-2)26-17(21-22)11-5-4-6-12(20)7-11/h4-9,18H,1-3H3/t18-/m0/s1 |
| InChIKey | YAJCOUWWLQEWCT-SFHVURJKSA-N |
| XLogP | 4.31 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.14 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|