C20H30BrN3O — CID 98336452
(3S,5S)-N-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3,5-dimethyladamantane-1-carboxamide (PubChem CID 98336452) has the molecular formula C20H30BrN3O and a molecular weight of 408.38 g/mol. Its IUPAC name is (3S,5S)-N-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3,5-dimethyladamantane-1-carboxamide.
| Compound Name | (3S,5S)-N-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3,5-dimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 98336452 |
| Molecular Formula | C20H30BrN3O |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | (3S,5S)-N-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3,5-dimethyladamantane-1-carboxamide |
| SMILES | Cc1nn(CCCNC(=O)C23CC4C[C@](C)(C2)C[C@](C)(C4)C3)cc1Br |
| InChI | InChI=1S/C20H30BrN3O/c1-14-16(21)10-24(23-14)6-4-5-22-17(25)20-9-15-7-18(2,12-20)11-19(3,8-15)13-20/h10,15H,4-9,11-13H2,1-3H3,(H,22,25)/t15?,18-,19-,20?/m0/s1 |
| InChIKey | ZFDPCLGLJNEPEA-DSOJJBLGSA-N |
| XLogP | 4.46 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|