C20H27N9S — CID 98337050
4-(1-ethyl-5-methylpyrazol-4-yl)-3-[(5R,7R)-3-(5-methyltetrazol-2-yl)-1-adamantyl]-1H-1,2,4-triazole-5-thione (PubChem CID 98337050) has the molecular formula C20H27N9S and a molecular weight of 425.57 g/mol. Its IUPAC name is 4-(1-ethyl-5-methylpyrazol-4-yl)-3-[(5R,7R)-3-(5-methyltetrazol-2-yl)-1-adamantyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(1-ethyl-5-methylpyrazol-4-yl)-3-[(5R,7R)-3-(5-methyltetrazol-2-yl)-1-adamantyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 98337050 |
| Molecular Formula | C20H27N9S |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 4-(1-ethyl-5-methylpyrazol-4-yl)-3-[(5R,7R)-3-(5-methyltetrazol-2-yl)-1-adamantyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CCn1ncc(-n2c(C34C[C@H]5C[C@H](C3)CC(n3nnc(C)n3)(C5)C4)n[nH]c2=S)c1C |
| InChI | InChI=1S/C20H27N9S/c1-4-27-12(2)16(10-21-27)28-17(23-24-18(28)30)19-6-14-5-15(7-19)9-20(8-14,11-19)29-25-13(3)22-26-29/h10,14-15H,4-9,11H2,1-3H3,(H,24,30)/t14-,15-,19?,20?/m1/s1 |
| InChIKey | VLDXSBXWISHEAJ-SNEKZUEESA-N |
| XLogP | 3.00 |
| TPSA | 95.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|