C18H24Br2N2O3 — CID 98338532
N-cyclohexyl-2-[(1R,2S,6S,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-methylacetamide (PubChem CID 98338532) has the molecular formula C18H24Br2N2O3 and a molecular weight of 476.21 g/mol. Its IUPAC name is N-cyclohexyl-2-[(1R,2S,6S,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-methylacetamide.
| Compound Name | N-cyclohexyl-2-[(1R,2S,6S,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 98338532 |
| Molecular Formula | C18H24Br2N2O3 |
| Molecular Weight | 476.21 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | N-cyclohexyl-2-[(1R,2S,6S,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-methylacetamide |
| SMILES | CN(C(=O)CN1C(=O)[C@@H]2[C@H]3C[C@@H]([C@@H](Br)[C@H]3Br)[C@H]2C1=O)C1CCCCC1 |
| InChI | InChI=1S/C18H24Br2N2O3/c1-21(9-5-3-2-4-6-9)12(23)8-22-17(24)13-10-7-11(14(13)18(22)25)16(20)15(10)19/h9-11,13-16H,2-8H2,1H3/t10-,11-,13-,14-,15-,16+/m1/s1 |
| InChIKey | YJMSSGMPNZCKDR-WMLLRYHISA-N |
| XLogP | 2.56 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.21 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|