C22H28ClN3O3 — CID 98340125
N-(4-chloro-2,5-dimethoxyphenyl)-2-[(3R)-3-methyl-4-(4-methylphenyl)piperazin-1-yl]acetamide (PubChem CID 98340125) has the molecular formula C22H28ClN3O3 and a molecular weight of 417.94 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-2-[(3R)-3-methyl-4-(4-methylphenyl)piperazin-1-yl]acetamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-[(3R)-3-methyl-4-(4-methylphenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 98340125 |
| Molecular Formula | C22H28ClN3O3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-[(3R)-3-methyl-4-(4-methylphenyl)piperazin-1-yl]acetamide |
| SMILES | COc1cc(NC(=O)CN2CCN(c3ccc(C)cc3)[C@H](C)C2)c(OC)cc1Cl |
| InChI | InChI=1S/C22H28ClN3O3/c1-15-5-7-17(8-6-15)26-10-9-25(13-16(26)2)14-22(27)24-19-12-20(28-3)18(23)11-21(19)29-4/h5-8,11-12,16H,9-10,13-14H2,1-4H3,(H,24,27)/t16-/m1/s1 |
| InChIKey | XGCKBXJOWLLYNT-MRXNPFEDSA-N |
| XLogP | 3.81 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|