C26H34NO2P — CID 98340750
(2S)-3-(2-diphenylphosphorylethyl)-2-[(1S,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-oxazolidine (PubChem CID 98340750) has the molecular formula C26H34NO2P and a molecular weight of 423.54 g/mol. Its IUPAC name is (2S)-3-(2-diphenylphosphorylethyl)-2-[(1S,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-oxazolidine.
| Compound Name | (2S)-3-(2-diphenylphosphorylethyl)-2-[(1S,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-oxazolidine |
|---|---|
| PubChem CID | 98340750 |
| Molecular Formula | C26H34NO2P |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | (2S)-3-(2-diphenylphosphorylethyl)-2-[(1S,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-oxazolidine |
| SMILES | CC1=C[C@H](C)[C@@H]([C@@H]2OCCN2CCP(=O)(c2ccccc2)c2ccccc2)[C@H](C)C1 |
| InChI | InChI=1S/C26H34NO2P/c1-20-18-21(2)25(22(3)19-20)26-27(14-16-29-26)15-17-30(28,23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-13,18,21-22,25-26H,14-17,19H2,1-3H3/t21-,22+,25+,26-/m0/s1 |
| InChIKey | JAPABBMFYHDZMU-VNRZQXBUSA-N |
| XLogP | 4.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|