C29H34N2O3 — CID 98342087
(3aS,7aS)-2-[(2S)-1-oxo-1-[(4S)-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl]propan-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 98342087) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is (3aS,7aS)-2-[(2S)-1-oxo-1-[(4S)-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl]propan-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aS)-2-[(2S)-1-oxo-1-[(4S)-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl]propan-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 98342087 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | (3aS,7aS)-2-[(2S)-1-oxo-1-[(4S)-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl]propan-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | C[C@@H](C(=O)N1c2ccccc2[C@](C)(c2ccccc2)CC1(C)C)N1C(=O)[C@H]2CCCC[C@@H]2C1=O |
| InChI | InChI=1S/C29H34N2O3/c1-19(30-26(33)21-14-8-9-15-22(21)27(30)34)25(32)31-24-17-11-10-16-23(24)29(4,18-28(31,2)3)20-12-6-5-7-13-20/h5-7,10-13,16-17,19,21-22H,8-9,14-15,18H2,1-4H3/t19-,21-,22-,29-/m0/s1 |
| InChIKey | HYBFQIXAQRMZGS-GKHSXJPSSA-N |
| XLogP | 5.07 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|