C25H37NO — CID 98342121
(3R)-2,2-dimethyl-3-phenyl-7-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]hept-5-yn-3-ol (PubChem CID 98342121) has the molecular formula C25H37NO and a molecular weight of 367.58 g/mol. Its IUPAC name is (3R)-2,2-dimethyl-3-phenyl-7-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]hept-5-yn-3-ol.
| Compound Name | (3R)-2,2-dimethyl-3-phenyl-7-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]hept-5-yn-3-ol |
|---|---|
| PubChem CID | 98342121 |
| Molecular Formula | C25H37NO |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.29 |
| IUPAC Name | (3R)-2,2-dimethyl-3-phenyl-7-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]hept-5-yn-3-ol |
| SMILES | CC1(C)C[C@@H]2C[C@](C)(CN2CC#CC[C@](O)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C25H37NO/c1-22(2,3)25(27,20-12-8-7-9-13-20)14-10-11-15-26-19-24(6)17-21(26)16-23(4,5)18-24/h7-9,12-13,21,27H,14-19H2,1-6H3/t21-,24+,25+/m1/s1 |
| InChIKey | FMISKHXPDOXXJM-ZODMCCGTSA-N |
| XLogP | 5.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|