C13H14BrN3O3 — CID 98342299
(1R,4R)-N-(4-bromo-3-nitrophenyl)-2-azabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 98342299) has the molecular formula C13H14BrN3O3 and a molecular weight of 340.18 g/mol. Its IUPAC name is (1R,4R)-N-(4-bromo-3-nitrophenyl)-2-azabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,4R)-N-(4-bromo-3-nitrophenyl)-2-azabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 98342299 |
| Molecular Formula | C13H14BrN3O3 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | (1R,4R)-N-(4-bromo-3-nitrophenyl)-2-azabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(Nc1ccc(Br)c([N+](=O)[O-])c1)N1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C13H14BrN3O3/c14-11-4-2-9(6-12(11)17(19)20)15-13(18)16-7-8-1-3-10(16)5-8/h2,4,6,8,10H,1,3,5,7H2,(H,15,18)/t8-,10-/m1/s1 |
| InChIKey | OVGOIGDAFZOGBD-PSASIEDQSA-N |
| XLogP | 3.37 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|