C24H27N3O2 — CID 98342869
(2R,6R,7S)-7-(4-methylphenyl)-4-(2,4,6-trimethylphenyl)-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione (PubChem CID 98342869) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is (2R,6R,7S)-7-(4-methylphenyl)-4-(2,4,6-trimethylphenyl)-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione.
| Compound Name | (2R,6R,7S)-7-(4-methylphenyl)-4-(2,4,6-trimethylphenyl)-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione |
|---|---|
| PubChem CID | 98342869 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | (2R,6R,7S)-7-(4-methylphenyl)-4-(2,4,6-trimethylphenyl)-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione |
| SMILES | Cc1ccc([C@@H]2[C@H]3C(=O)N(c4c(C)cc(C)cc4C)C(=O)[C@@H]3N3CCCN23)cc1 |
| InChI | InChI=1S/C24H27N3O2/c1-14-6-8-18(9-7-14)21-19-22(26-11-5-10-25(21)26)24(29)27(23(19)28)20-16(3)12-15(2)13-17(20)4/h6-9,12-13,19,21-22H,5,10-11H2,1-4H3/t19-,21-,22-/m1/s1 |
| InChIKey | NFRKPKLAMJLZRA-CEMLEFRQSA-N |
| XLogP | 3.46 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|