C31H32N2O3 — CID 98345048
N-[(3aS,4R,7S,7aR)-1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl]adamantane-1-carboxamide (PubChem CID 98345048) has the molecular formula C31H32N2O3 and a molecular weight of 480.61 g/mol. Its IUPAC name is N-[(3aS,4R,7S,7aR)-1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl]adamantane-1-carboxamide.
| Compound Name | N-[(3aS,4R,7S,7aR)-1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98345048 |
| Molecular Formula | C31H32N2O3 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | N-[(3aS,4R,7S,7aR)-1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl]adamantane-1-carboxamide |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1NC(=O)C13CC4CC(CC(C4)C1)C3)[C@@H](c1ccccc1)C=C[C@H]2c1ccccc1 |
| InChI | InChI=1S/C31H32N2O3/c34-28-26-24(22-7-3-1-4-8-22)11-12-25(23-9-5-2-6-10-23)27(26)29(35)33(28)32-30(36)31-16-19-13-20(17-31)15-21(14-19)18-31/h1-12,19-21,24-27H,13-18H2,(H,32,36)/t19?,20?,21?,24-,25+,26-,27+,31? |
| InChIKey | WHGIPLIXTQXHJO-BUOPKALWSA-N |
| XLogP | 4.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|