C33H31N3O4 — CID 98345528
(4E,5S)-5-[4-(dimethylamino)phenyl]-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 98345528) has the molecular formula C33H31N3O4 and a molecular weight of 533.63 g/mol. Its IUPAC name is (4E,5S)-5-[4-(dimethylamino)phenyl]-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-5-[4-(dimethylamino)phenyl]-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98345528 |
| Molecular Formula | C33H31N3O4 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | (4E,5S)-5-[4-(dimethylamino)phenyl]-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | Cc1cccc(COc2ccc(/C(O)=C3\C(=O)C(=O)N(Cc4cccnc4)[C@H]3c3ccc(N(C)C)cc3)cc2)c1 |
| InChI | InChI=1S/C33H31N3O4/c1-22-6-4-7-23(18-22)21-40-28-15-11-26(12-16-28)31(37)29-30(25-9-13-27(14-10-25)35(2)3)36(33(39)32(29)38)20-24-8-5-17-34-19-24/h4-19,30,37H,20-21H2,1-3H3/b31-29+/t30-/m0/s1 |
| InChIKey | MVKIGOXRTJSYLC-QMMFTLRZSA-N |
| XLogP | 5.66 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|