C18H16N4O2 — CID 98349534
(1R,3S,4S,5S,8R)-5-hydroxy-4,8-dimethyl-7-oxo-3-phenyl-6-azabicyclo[3.2.1]octane-1,2,2-tricarbonitrile (PubChem CID 98349534) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is (1R,3S,4S,5S,8R)-5-hydroxy-4,8-dimethyl-7-oxo-3-phenyl-6-azabicyclo[3.2.1]octane-1,2,2-tricarbonitrile.
| Compound Name | (1R,3S,4S,5S,8R)-5-hydroxy-4,8-dimethyl-7-oxo-3-phenyl-6-azabicyclo[3.2.1]octane-1,2,2-tricarbonitrile |
|---|---|
| PubChem CID | 98349534 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (1R,3S,4S,5S,8R)-5-hydroxy-4,8-dimethyl-7-oxo-3-phenyl-6-azabicyclo[3.2.1]octane-1,2,2-tricarbonitrile |
| SMILES | C[C@H]1[C@@H](c2ccccc2)C(C#N)(C#N)[C@]2(C#N)C(=O)N[C@@]1(O)[C@@H]2C |
| InChI | InChI=1S/C18H16N4O2/c1-11-14(13-6-4-3-5-7-13)16(8-19,9-20)17(10-21)12(2)18(11,24)22-15(17)23/h3-7,11-12,14,24H,1-2H3,(H,22,23)/t11-,12+,14-,17-,18-/m0/s1 |
| InChIKey | AZXRGFZUTBOBIM-XSSYPUMDSA-N |
| XLogP | 1.42 |
| TPSA | 120.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |