About N-[[(5R,7R)-3-chloro-1-adamantyl]methyl]azepane-1-sulfonamide
N-[[(5R,7R)-3-chloro-1-adamantyl]methyl]azepane-1-sulfonamide (PubChem CID 98349934) has the molecular formula C17H29ClN2O2S
and a molecular weight of 360.95 g/mol. Its IUPAC name is N-[[(5R,7R)-3-chloro-1-adamantyl]methyl]azepane-1-sulfonamide.
Molecular Properties
| Compound Name | N-[[(5R,7R)-3-chloro-1-adamantyl]methyl]azepane-1-sulfonamide |
| PubChem CID | 98349934 |
| Molecular Formula | C17H29ClN2O2S |
| Molecular Weight | 360.95 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-[[(5R,7R)-3-chloro-1-adamantyl]methyl]azepane-1-sulfonamide |
| SMILES | O=S(=O)(NCC12C[C@H]3C[C@@H](CC(Cl)(C3)C1)C2)N1CCCCCC1 |
| InChI | InChI=1S/C17H29ClN2O2S/c18-17-10-14-7-15(11-17)9-16(8-14,12-17)13-19-23(21,22)20-5-3-1-2-4-6-20/h14-15,19H,1-13H2/t14-,15-,16?,17?/m1/s1 |
| InChIKey | IDINFQHVHVMPIV-NUWOQIAWSA-N |
| XLogP | 3.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.95 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[[(5R,7R)-3-chloro-1-adamantyl]methyl]azepane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(5R,7R)-3-chloro-1-adamantyl]methyl]azepane-1-sulfonamide?
The IUPAC name of N-[[(5R,7R)-3-chloro-1-adamantyl]methyl]azepane-1-sulfonamide (CID 98349934) is N-[[(5R,7R)-3-chloro-1-adamantyl]methyl]azepane-1-sulfonamide.
What is the SMILES notation for N-[[(5R,7R)-3-chloro-1-adamantyl]methyl]azepane-1-sulfonamide?
The canonical SMILES for N-[[(5R,7R)-3-chloro-1-adamantyl]methyl]azepane-1-sulfonamide is O=S(=O)(NCC12C[C@H]3C[C@@H](CC(Cl)(C3)C1)C2)N1CCCCCC1.
What is the InChIKey of N-[[(5R,7R)-3-chloro-1-adamantyl]methyl]azepane-1-sulfonamide?
The InChIKey is IDINFQHVHVMPIV-NUWOQIAWSA-N. The full InChI is InChI=1S/C17H29ClN2O2S/c18-17-10-14-7-15(11-17)9-16(8-14,12-17)13-19-23(21,22)20-5-3-1-2-4-6-20/h14-15,19H,1-13H2/t14-,15-,16?,17?/m1/s1.
What are the key properties of N-[[(5R,7R)-3-chloro-1-adamantyl]methyl]azepane-1-sulfonamide?
N-[[(5R,7R)-3-chloro-1-adamantyl]methyl]azepane-1-sulfonamide has a molecular weight of 360.95 g/mol, XLogP of 3.27, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(5R,7R)-3-chloro-1-adamantyl]methyl]azepane-1-sulfonamide is sourced from PubChem (CID 98349934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).