C27H24N2O7 — CID 98352740
6-[(3S,3aR,6aR)-5-(4-methylphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2,3-dimethoxybenzoic acid (PubChem CID 98352740) has the molecular formula C27H24N2O7 and a molecular weight of 488.50 g/mol. Its IUPAC name is 6-[(3S,3aR,6aR)-5-(4-methylphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2,3-dimethoxybenzoic acid.
| Compound Name | 6-[(3S,3aR,6aR)-5-(4-methylphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2,3-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 98352740 |
| Molecular Formula | C27H24N2O7 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 6-[(3S,3aR,6aR)-5-(4-methylphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2,3-dimethoxybenzoic acid |
| SMILES | COc1ccc([C@@H]2[C@H]3C(=O)N(c4ccc(C)cc4)C(=O)[C@@H]3ON2c2ccccc2)c(C(=O)O)c1OC |
| InChI | InChI=1S/C27H24N2O7/c1-15-9-11-16(12-10-15)28-25(30)21-22(18-13-14-19(34-2)23(35-3)20(18)27(32)33)29(36-24(21)26(28)31)17-7-5-4-6-8-17/h4-14,21-22,24H,1-3H3,(H,32,33)/t21-,22-,24-/m1/s1 |
| InChIKey | MGSRZZZNMSSJNF-CQOQZXRMSA-N |
| XLogP | 3.76 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|