C21H23BrN2O3S — CID 98352912
(1S,9R)-4-bromo-10-[2-(3,4-dimethoxyphenyl)ethyl]-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione (PubChem CID 98352912) has the molecular formula C21H23BrN2O3S and a molecular weight of 463.40 g/mol. Its IUPAC name is (1S,9R)-4-bromo-10-[2-(3,4-dimethoxyphenyl)ethyl]-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione.
| Compound Name | (1S,9R)-4-bromo-10-[2-(3,4-dimethoxyphenyl)ethyl]-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione |
|---|---|
| PubChem CID | 98352912 |
| Molecular Formula | C21H23BrN2O3S |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | (1S,9R)-4-bromo-10-[2-(3,4-dimethoxyphenyl)ethyl]-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione |
| SMILES | COc1ccc(CCN2C(=S)N[C@H]3C[C@@]2(C)Oc2ccc(Br)cc23)cc1OC |
| InChI | InChI=1S/C21H23BrN2O3S/c1-21-12-16(15-11-14(22)5-7-17(15)27-21)23-20(28)24(21)9-8-13-4-6-18(25-2)19(10-13)26-3/h4-7,10-11,16H,8-9,12H2,1-3H3,(H,23,28)/t16-,21+/m0/s1 |
| InChIKey | DKAJDBOQVDKUDY-HRAATJIYSA-N |
| XLogP | 4.44 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|