C23H19ClN2O4 — CID 98353776
2-[4-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2-methylphenyl]-5-chloroisoindole-1,3-dione (PubChem CID 98353776) has the molecular formula C23H19ClN2O4 and a molecular weight of 422.87 g/mol. Its IUPAC name is 2-[4-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2-methylphenyl]-5-chloroisoindole-1,3-dione.
| Compound Name | 2-[4-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2-methylphenyl]-5-chloroisoindole-1,3-dione |
|---|---|
| PubChem CID | 98353776 |
| Molecular Formula | C23H19ClN2O4 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 2-[4-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2-methylphenyl]-5-chloroisoindole-1,3-dione |
| SMILES | Cc1cc(N2C(=O)[C@@H]3CCCC[C@H]3C2=O)ccc1N1C(=O)c2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C23H19ClN2O4/c1-12-10-14(25-20(27)15-4-2-3-5-16(15)21(25)28)7-9-19(12)26-22(29)17-8-6-13(24)11-18(17)23(26)30/h6-11,15-16H,2-5H2,1H3/t15-,16-/m1/s1 |
| InChIKey | KBDCZGMPJXPZEI-HZPDHXFCSA-N |
| XLogP | 4.13 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|