C20H27N3O2 — CID 98354419
(2S)-N-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-methyl-2-(2-oxopyrrolidin-1-yl)butanamide (PubChem CID 98354419) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is (2S)-N-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-methyl-2-(2-oxopyrrolidin-1-yl)butanamide.
| Compound Name | (2S)-N-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-methyl-2-(2-oxopyrrolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 98354419 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (2S)-N-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-methyl-2-(2-oxopyrrolidin-1-yl)butanamide |
| SMILES | CC(C)[C@@H](C(=O)NCc1cccc(N2CC=CC2)c1)N1CCCC1=O |
| InChI | InChI=1S/C20H27N3O2/c1-15(2)19(23-12-6-9-18(23)24)20(25)21-14-16-7-5-8-17(13-16)22-10-3-4-11-22/h3-5,7-8,13,15,19H,6,9-12,14H2,1-2H3,(H,21,25)/t19-/m0/s1 |
| InChIKey | VKTPNYNTKHSDCI-IBGZPJMESA-N |
| XLogP | 2.33 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|