C14H17F3N4O — CID 98354757
[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 98354757) has the molecular formula C14H17F3N4O and a molecular weight of 314.31 g/mol. Its IUPAC name is [(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | [(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 98354757 |
| Molecular Formula | C14H17F3N4O |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | [(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | O=C([C@H]1C[C@H]2CC[C@H]1C2)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C14H17F3N4O/c15-14(16,17)13-19-18-11-7-20(3-4-21(11)13)12(22)10-6-8-1-2-9(10)5-8/h8-10H,1-7H2/t8-,9-,10-/m0/s1 |
| InChIKey | DTCGKHNYWHBUIS-GUBZILKMSA-N |
| XLogP | 2.08 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |