C22H24ClN3O4 — CID 98355146
(4E,5R)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-pyridin-3-ylpyrrolidine-2,3-dione (PubChem CID 98355146) has the molecular formula C22H24ClN3O4 and a molecular weight of 429.90 g/mol. Its IUPAC name is (4E,5R)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-pyridin-3-ylpyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-pyridin-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98355146 |
| Molecular Formula | C22H24ClN3O4 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | (4E,5R)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-pyridin-3-ylpyrrolidine-2,3-dione |
| SMILES | COc1ccc(Cl)cc1/C(O)=C1\C(=O)C(=O)N(CCCN(C)C)[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C22H24ClN3O4/c1-25(2)10-5-11-26-19(14-6-4-9-24-13-14)18(21(28)22(26)29)20(27)16-12-15(23)7-8-17(16)30-3/h4,6-9,12-13,19,27H,5,10-11H2,1-3H3/b20-18+/t19-/m1/s1 |
| InChIKey | LRFYMRUAJBHPPZ-LFVOPCPISA-N |
| XLogP | 3.12 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|