C23H28N4O5 — CID 98357345
(4E,5S)-5-(3,4-dimethoxyphenyl)-1-[2-(dimethylamino)ethyl]-4-[(2,4-dimethylpyrimidin-5-yl)-hydroxymethylidene]pyrrolidine-2,3-dione (PubChem CID 98357345) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is (4E,5S)-5-(3,4-dimethoxyphenyl)-1-[2-(dimethylamino)ethyl]-4-[(2,4-dimethylpyrimidin-5-yl)-hydroxymethylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-5-(3,4-dimethoxyphenyl)-1-[2-(dimethylamino)ethyl]-4-[(2,4-dimethylpyrimidin-5-yl)-hydroxymethylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98357345 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | (4E,5S)-5-(3,4-dimethoxyphenyl)-1-[2-(dimethylamino)ethyl]-4-[(2,4-dimethylpyrimidin-5-yl)-hydroxymethylidene]pyrrolidine-2,3-dione |
| SMILES | COc1ccc([C@H]2/C(=C(\O)c3cnc(C)nc3C)C(=O)C(=O)N2CCN(C)C)cc1OC |
| InChI | InChI=1S/C23H28N4O5/c1-13-16(12-24-14(2)25-13)21(28)19-20(15-7-8-17(31-5)18(11-15)32-6)27(10-9-26(3)4)23(30)22(19)29/h7-8,11-12,20,28H,9-10H2,1-6H3/b21-19+/t20-/m0/s1 |
| InChIKey | HBZIAYRICOFCSG-NHFXJNLRSA-N |
| XLogP | 2.09 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|