C20H23FN4O3 — CID 98359021
(4E,5S)-1-[2-(dimethylamino)ethyl]-4-[(3,5-dimethyl-1H-pyrazol-4-yl)-hydroxymethylidene]-5-(2-fluorophenyl)pyrrolidine-2,3-dione (PubChem CID 98359021) has the molecular formula C20H23FN4O3 and a molecular weight of 386.43 g/mol. Its IUPAC name is (4E,5S)-1-[2-(dimethylamino)ethyl]-4-[(3,5-dimethyl-1H-pyrazol-4-yl)-hydroxymethylidene]-5-(2-fluorophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-1-[2-(dimethylamino)ethyl]-4-[(3,5-dimethyl-1H-pyrazol-4-yl)-hydroxymethylidene]-5-(2-fluorophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98359021 |
| Molecular Formula | C20H23FN4O3 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | (4E,5S)-1-[2-(dimethylamino)ethyl]-4-[(3,5-dimethyl-1H-pyrazol-4-yl)-hydroxymethylidene]-5-(2-fluorophenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1n[nH]c(C)c1/C(O)=C1\C(=O)C(=O)N(CCN(C)C)[C@@H]1c1ccccc1F |
| InChI | InChI=1S/C20H23FN4O3/c1-11-15(12(2)23-22-11)18(26)16-17(13-7-5-6-8-14(13)21)25(10-9-24(3)4)20(28)19(16)27/h5-8,17,26H,9-10H2,1-4H3,(H,22,23)/b18-16+/t17-/m1/s1 |
| InChIKey | CKWQEOKIIUAQLF-GROYHEBESA-N |
| XLogP | 2.15 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|