C29H24ClN5O4 — CID 98359578
1-[2-[(4R)-4-(4-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-1-cyclopropyl-3-(4-nitrophenyl)urea (PubChem CID 98359578) has the molecular formula C29H24ClN5O4 and a molecular weight of 542.00 g/mol. Its IUPAC name is 1-[2-[(4R)-4-(4-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-1-cyclopropyl-3-(4-nitrophenyl)urea.
| Compound Name | 1-[2-[(4R)-4-(4-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-1-cyclopropyl-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 98359578 |
| Molecular Formula | C29H24ClN5O4 |
| Molecular Weight | 542.00 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | 1-[2-[(4R)-4-(4-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]-2-oxoethyl]-1-cyclopropyl-3-(4-nitrophenyl)urea |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)N(CC(=O)N1c2ccccc2-n2cccc2[C@H]1c1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C29H24ClN5O4/c30-20-9-7-19(8-10-20)28-26-6-3-17-32(26)24-4-1-2-5-25(24)34(28)27(36)18-33(22-15-16-22)29(37)31-21-11-13-23(14-12-21)35(38)39/h1-14,17,22,28H,15-16,18H2,(H,31,37)/t28-/m1/s1 |
| InChIKey | KNCQIPJPALDSAH-MUUNZHRXSA-N |
| XLogP | 6.17 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.00 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|