C21H32N2O3S — CID 98360480
N-butyl-3-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]sulfonyl]benzamide (PubChem CID 98360480) has the molecular formula C21H32N2O3S and a molecular weight of 392.57 g/mol. Its IUPAC name is N-butyl-3-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]sulfonyl]benzamide.
| Compound Name | N-butyl-3-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]sulfonyl]benzamide |
|---|---|
| PubChem CID | 98360480 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N-butyl-3-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]sulfonyl]benzamide |
| SMILES | CCCCNC(=O)c1cccc(S(=O)(=O)N2C[C@]3(C)C[C@@H]2CC(C)(C)C3)c1 |
| InChI | InChI=1S/C21H32N2O3S/c1-5-6-10-22-19(24)16-8-7-9-18(11-16)27(25,26)23-15-21(4)13-17(23)12-20(2,3)14-21/h7-9,11,17H,5-6,10,12-15H2,1-4H3,(H,22,24)/t17-,21+/m0/s1 |
| InChIKey | UWOZITOJASJEQZ-LAUBAEHRSA-N |
| XLogP | 3.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|