C12H12N2O2S2 — CID 98360577
(2S)-3-oxo-2-(thiomorpholine-4-carbonyl)-3-thiophen-3-ylpropanenitrile (PubChem CID 98360577) has the molecular formula C12H12N2O2S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is (2S)-3-oxo-2-(thiomorpholine-4-carbonyl)-3-thiophen-3-ylpropanenitrile.
| Compound Name | (2S)-3-oxo-2-(thiomorpholine-4-carbonyl)-3-thiophen-3-ylpropanenitrile |
|---|---|
| PubChem CID | 98360577 |
| Molecular Formula | C12H12N2O2S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | (2S)-3-oxo-2-(thiomorpholine-4-carbonyl)-3-thiophen-3-ylpropanenitrile |
| SMILES | N#C[C@@H](C(=O)c1ccsc1)C(=O)N1CCSCC1 |
| InChI | InChI=1S/C12H12N2O2S2/c13-7-10(11(15)9-1-4-18-8-9)12(16)14-2-5-17-6-3-14/h1,4,8,10H,2-3,5-6H2/t10-/m0/s1 |
| InChIKey | NQJPVIVKIGCIFI-JTQLQIEISA-N |
| XLogP | 1.65 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|