C23H17FN2O5 — CID 98360999
(3R,3aS,6aS)-3-(3,4-dihydroxyphenyl)-5-(4-fluorophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 98360999) has the molecular formula C23H17FN2O5 and a molecular weight of 420.40 g/mol. Its IUPAC name is (3R,3aS,6aS)-3-(3,4-dihydroxyphenyl)-5-(4-fluorophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3R,3aS,6aS)-3-(3,4-dihydroxyphenyl)-5-(4-fluorophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 98360999 |
| Molecular Formula | C23H17FN2O5 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | (3R,3aS,6aS)-3-(3,4-dihydroxyphenyl)-5-(4-fluorophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C1[C@@H]2[C@H](ON(c3ccccc3)[C@H]2c2ccc(O)c(O)c2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C23H17FN2O5/c24-14-7-9-15(10-8-14)25-22(29)19-20(13-6-11-17(27)18(28)12-13)26(31-21(19)23(25)30)16-4-2-1-3-5-16/h1-12,19-21,27-28H/t19-,20-,21-/m0/s1 |
| InChIKey | ZYLNGPQLLWQJDG-ACRUOGEOSA-N |
| XLogP | 3.29 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|