C21H23N3O2 — CID 98361078
[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-[(2R)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]methanone (PubChem CID 98361078) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is [(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-[(2R)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]methanone.
| Compound Name | [(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-[(2R)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 98361078 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | [(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-[(2R)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]methanone |
| SMILES | O=C([C@H]1C[C@H]2C=C[C@H]1C2)N1CCCC[C@@H]1c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C21H23N3O2/c25-21(17-13-14-9-10-16(17)12-14)24-11-5-4-8-18(24)20-22-19(23-26-20)15-6-2-1-3-7-15/h1-3,6-7,9-10,14,16-18H,4-5,8,11-13H2/t14-,16-,17-,18+/m0/s1 |
| InChIKey | INWYLJANKLYLOW-LEUOFYLZSA-N |
| XLogP | 4.00 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|