C19H25N3O2 — CID 98361735
N-[1-[(1R,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperidin-4-yl]-1-methylpyrrole-2-carboxamide (PubChem CID 98361735) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[1-[(1R,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperidin-4-yl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[1-[(1R,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperidin-4-yl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 98361735 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | N-[1-[(1R,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperidin-4-yl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)NC1CCN(C(=O)[C@@H]2C[C@H]3C=C[C@H]2C3)CC1 |
| InChI | InChI=1S/C19H25N3O2/c1-21-8-2-3-17(21)18(23)20-15-6-9-22(10-7-15)19(24)16-12-13-4-5-14(16)11-13/h2-5,8,13-16H,6-7,9-12H2,1H3,(H,20,23)/t13-,14-,16+/m0/s1 |
| InChIKey | IKCLSRTZVDXJTH-OFQRWUPVSA-N |
| XLogP | 1.96 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|