C34H34FN5O3 — CID 98362393
3-[(4-ethylphenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]benzamide (PubChem CID 98362393) has the molecular formula C34H34FN5O3 and a molecular weight of 579.68 g/mol. Its IUPAC name is 3-[(4-ethylphenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]benzamide.
| Compound Name | 3-[(4-ethylphenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]benzamide |
|---|---|
| PubChem CID | 98362393 |
| Molecular Formula | C34H34FN5O3 |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | 3-[(4-ethylphenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]benzamide |
| SMILES | CCc1ccc(NC(=O)Nc2cc(C(=O)NCc3ccc(F)cc3)ccc2N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 |
| InChI | InChI=1S/C34H34FN5O3/c1-2-22-8-13-28(14-9-22)37-34(43)38-29-17-25(33(42)36-18-23-6-11-27(35)12-7-23)10-15-31(29)39-19-24-16-26(21-39)30-4-3-5-32(41)40(30)20-24/h3-15,17,24,26H,2,16,18-21H2,1H3,(H,36,42)(H2,37,38,43)/t24-,26+/m1/s1 |
| InChIKey | QTLNMCYPOWKIFO-RSXGOPAZSA-N |
| XLogP | 5.75 |
| TPSA | 95.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |