C11H18N2O3 — CID 98362742
(1R,2R,4S)-2-hydroxy-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carbohydrazide (PubChem CID 98362742) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is (1R,2R,4S)-2-hydroxy-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carbohydrazide.
| Compound Name | (1R,2R,4S)-2-hydroxy-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carbohydrazide |
|---|---|
| PubChem CID | 98362742 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | (1R,2R,4S)-2-hydroxy-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carbohydrazide |
| SMILES | CC1(C)[C@]2(C(=O)NN)CC[C@]1(C)C(=O)[C@@H]2O |
| InChI | InChI=1S/C11H18N2O3/c1-9(2)10(3)4-5-11(9,8(16)13-12)7(15)6(10)14/h7,15H,4-5,12H2,1-3H3,(H,13,16)/t7-,10+,11+/m0/s1 |
| InChIKey | OGZXDCUCOMZMJZ-WHGOUJPWSA-N |
| XLogP | -0.27 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|