C22H18ClN3O4 — CID 98365005
(1R,2S,6R,7R)-4-[4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 98365005) has the molecular formula C22H18ClN3O4 and a molecular weight of 423.86 g/mol. Its IUPAC name is (1R,2S,6R,7R)-4-[4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6R,7R)-4-[4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98365005 |
| Molecular Formula | C22H18ClN3O4 |
| Molecular Weight | 423.86 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | (1R,2S,6R,7R)-4-[4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1c1ccc(NCc3ccccc3Cl)c([N+](=O)[O-])c1)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C22H18ClN3O4/c23-16-4-2-1-3-14(16)11-24-17-8-7-15(10-18(17)26(29)30)25-21(27)19-12-5-6-13(9-12)20(19)22(25)28/h1-8,10,12-13,19-20,24H,9,11H2/t12-,13-,19-,20+/m0/s1 |
| InChIKey | LVILPEWEXXTHSQ-USEHDAJUSA-N |
| XLogP | 4.17 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.86 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|