C23H28FN3O — CID 98365516
2-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-N-[(1S,2R,6S,7R,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide (PubChem CID 98365516) has the molecular formula C23H28FN3O and a molecular weight of 381.50 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-N-[(1S,2R,6S,7R,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide.
| Compound Name | 2-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-N-[(1S,2R,6S,7R,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide |
|---|---|
| PubChem CID | 98365516 |
| Molecular Formula | C23H28FN3O |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 2-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-N-[(1S,2R,6S,7R,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1CC(=O)N[C@@H]1C[C@@H]2C[C@@H]1[C@H]1CCC[C@H]21 |
| InChI | InChI=1S/C23H28FN3O/c1-13-20(14(2)27(26-13)17-8-6-16(24)7-9-17)12-23(28)25-22-11-15-10-21(22)19-5-3-4-18(15)19/h6-9,15,18-19,21-22H,3-5,10-12H2,1-2H3,(H,25,28)/t15-,18+,19-,21+,22+/m0/s1 |
| InChIKey | PXNNOTNHODLLFS-BEILGFHUSA-N |
| XLogP | 4.11 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |