C17H26O3 — CID 98367695
methyl 2-[(4aR,6S,6aR,10bR)-6-methyl-1,2,3,4,4a,6a,7,8,9,10b-decahydrobenzo[c]chromen-6-yl]acetate (PubChem CID 98367695) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is methyl 2-[(4aR,6S,6aR,10bR)-6-methyl-1,2,3,4,4a,6a,7,8,9,10b-decahydrobenzo[c]chromen-6-yl]acetate.
| Compound Name | methyl 2-[(4aR,6S,6aR,10bR)-6-methyl-1,2,3,4,4a,6a,7,8,9,10b-decahydrobenzo[c]chromen-6-yl]acetate |
|---|---|
| PubChem CID | 98367695 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | methyl 2-[(4aR,6S,6aR,10bR)-6-methyl-1,2,3,4,4a,6a,7,8,9,10b-decahydrobenzo[c]chromen-6-yl]acetate |
| SMILES | COC(=O)C[C@]1(C)O[C@@H]2CCCC[C@@H]2C2=CCCC[C@H]21 |
| InChI | InChI=1S/C17H26O3/c1-17(11-16(18)19-2)14-9-5-3-7-12(14)13-8-4-6-10-15(13)20-17/h7,13-15H,3-6,8-11H2,1-2H3/t13-,14-,15-,17+/m1/s1 |
| InChIKey | WNVJVFWHEQPCPV-ANQUJSFKSA-N |
| XLogP | 3.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|