C28H26F3N3O5S — CID 98367899
2-[[(4R)-3-cyano-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinolin-2-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 98367899) has the molecular formula C28H26F3N3O5S and a molecular weight of 573.59 g/mol. Its IUPAC name is 2-[[(4R)-3-cyano-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinolin-2-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[(4R)-3-cyano-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinolin-2-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 98367899 |
| Molecular Formula | C28H26F3N3O5S |
| Molecular Weight | 573.59 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | 2-[[(4R)-3-cyano-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinolin-2-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1cc([C@H]2C(C#N)=C(SCC(=O)Nc3ccccc3C(F)(F)F)NC3=C2C(=O)CCC3)cc(OC)c1OC |
| InChI | InChI=1S/C28H26F3N3O5S/c1-37-21-11-15(12-22(38-2)26(21)39-3)24-16(13-32)27(34-19-9-6-10-20(35)25(19)24)40-14-23(36)33-18-8-5-4-7-17(18)28(29,30)31/h4-5,7-8,11-12,24,34H,6,9-10,14H2,1-3H3,(H,33,36)/t24-/m0/s1 |
| InChIKey | DHVBPUHCDBMIGV-DEOSSOPVSA-N |
| XLogP | 5.53 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |