About 2-(4-fluorophenyl)acetic acid
2-(4-fluorophenyl)acetic acid (PubChem CID 9837) has the molecular formula C8H7FO2
and a molecular weight of 154.14 g/mol. Its IUPAC name is 2-(4-fluorophenyl)acetic acid.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)acetic acid |
| PubChem CID | 9837 |
| Molecular Formula | C8H7FO2 |
| Molecular Weight | 154.14 g/mol |
| Exact Mass | 154.04 |
| IUPAC Name | 2-(4-fluorophenyl)acetic acid |
| SMILES | O=C(O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C8H7FO2/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | MGKPFALCNDRSQD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.14 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-fluorophenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)acetic acid?
The IUPAC name of 2-(4-fluorophenyl)acetic acid (CID 9837) is 2-(4-fluorophenyl)acetic acid.
What is the SMILES notation for 2-(4-fluorophenyl)acetic acid?
The canonical SMILES for 2-(4-fluorophenyl)acetic acid is O=C(O)Cc1ccc(F)cc1.
What is the InChIKey of 2-(4-fluorophenyl)acetic acid?
The InChIKey is MGKPFALCNDRSQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FO2/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2,(H,10,11).
What are the key properties of 2-(4-fluorophenyl)acetic acid?
2-(4-fluorophenyl)acetic acid has a molecular weight of 154.14 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)acetic acid is sourced from PubChem (CID 9837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).