C17H16N2O3 — CID 98370704
(2S)-N-(3-ethylphenyl)-3-oxo-4H-1,4-benzoxazine-2-carboxamide (PubChem CID 98370704) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is (2S)-N-(3-ethylphenyl)-3-oxo-4H-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2S)-N-(3-ethylphenyl)-3-oxo-4H-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 98370704 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (2S)-N-(3-ethylphenyl)-3-oxo-4H-1,4-benzoxazine-2-carboxamide |
| SMILES | CCc1cccc(NC(=O)[C@@H]2Oc3ccccc3NC2=O)c1 |
| InChI | InChI=1S/C17H16N2O3/c1-2-11-6-5-7-12(10-11)18-16(20)15-17(21)19-13-8-3-4-9-14(13)22-15/h3-10,15H,2H2,1H3,(H,18,20)(H,19,21)/t15-/m0/s1 |
| InChIKey | JUQOICUQQIDLOM-HNNXBMFYSA-N |
| XLogP | 2.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|