C27H21N3O7S — CID 98375161
(4E,5R)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 98375161) has the molecular formula C27H21N3O7S and a molecular weight of 531.55 g/mol. Its IUPAC name is (4E,5R)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98375161 |
| Molecular Formula | C27H21N3O7S |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | (4E,5R)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc2nc(N3C(=O)C(=O)/C(=C(/O)c4ccc(OC)cc4)[C@H]3c3ccc([N+](=O)[O-])cc3)sc2c1 |
| InChI | InChI=1S/C27H21N3O7S/c1-3-37-19-12-13-20-21(14-19)38-27(28-20)29-23(15-4-8-17(9-5-15)30(34)35)22(25(32)26(29)33)24(31)16-6-10-18(36-2)11-7-16/h4-14,23,31H,3H2,1-2H3/b24-22+/t23-/m1/s1 |
| InChIKey | MIAJJMMYMMMJHS-ZHHPLPSFSA-N |
| XLogP | 5.24 |
| TPSA | 132.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|