C40H34N4 — CID 98376115
2-[3-[(4R)-4,5-bis(4-methylphenyl)-4H-imidazol-2-yl]phenyl]-4,5-bis(4-methylphenyl)-1H-imidazole (PubChem CID 98376115) has the molecular formula C40H34N4 and a molecular weight of 570.74 g/mol. Its IUPAC name is 2-[3-[(4R)-4,5-bis(4-methylphenyl)-4H-imidazol-2-yl]phenyl]-4,5-bis(4-methylphenyl)-1H-imidazole.
| Compound Name | 2-[3-[(4R)-4,5-bis(4-methylphenyl)-4H-imidazol-2-yl]phenyl]-4,5-bis(4-methylphenyl)-1H-imidazole |
|---|---|
| PubChem CID | 98376115 |
| Molecular Formula | C40H34N4 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | 2-[3-[(4R)-4,5-bis(4-methylphenyl)-4H-imidazol-2-yl]phenyl]-4,5-bis(4-methylphenyl)-1H-imidazole |
| SMILES | Cc1ccc(C2=NC(c3cccc(-c4nc(-c5ccc(C)cc5)c(-c5ccc(C)cc5)[nH]4)c3)=N[C@@H]2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C40H34N4/c1-25-8-16-29(17-9-25)35-36(30-18-10-26(2)11-19-30)42-39(41-35)33-6-5-7-34(24-33)40-43-37(31-20-12-27(3)13-21-31)38(44-40)32-22-14-28(4)15-23-32/h5-24,35H,1-4H3,(H,43,44)/t35-/m1/s1 |
| InChIKey | JOCVEASSAWVELH-PGUFJCEWSA-N |
| XLogP | 9.64 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|