C31H30N2O6S — CID 98376431
(4E,5R)-1-(6-ethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-(3-methoxy-4-propoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 98376431) has the molecular formula C31H30N2O6S and a molecular weight of 558.66 g/mol. Its IUPAC name is (4E,5R)-1-(6-ethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-(3-methoxy-4-propoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-1-(6-ethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-(3-methoxy-4-propoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98376431 |
| Molecular Formula | C31H30N2O6S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | (4E,5R)-1-(6-ethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-(3-methoxy-4-propoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCOc1ccc([C@@H]2/C(=C(\O)c3ccc(OC)cc3)C(=O)C(=O)N2c2nc3ccc(CC)cc3s2)cc1OC |
| InChI | InChI=1S/C31H30N2O6S/c1-5-15-39-23-14-10-20(17-24(23)38-4)27-26(28(34)19-8-11-21(37-3)12-9-19)29(35)30(36)33(27)31-32-22-13-7-18(6-2)16-25(22)40-31/h7-14,16-17,27,34H,5-6,15H2,1-4H3/b28-26+/t27-/m1/s1 |
| InChIKey | SSGCWRQENYDSHZ-UUALVTFQSA-N |
| XLogP | 6.29 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|