C27H30Cl2N2O4 — CID 98377727
(4E,5R)-5-(3,4-dichlorophenyl)-1-[3-(diethylamino)propyl]-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione (PubChem CID 98377727) has the molecular formula C27H30Cl2N2O4 and a molecular weight of 517.45 g/mol. Its IUPAC name is (4E,5R)-5-(3,4-dichlorophenyl)-1-[3-(diethylamino)propyl]-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-5-(3,4-dichlorophenyl)-1-[3-(diethylamino)propyl]-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98377727 |
| Molecular Formula | C27H30Cl2N2O4 |
| Molecular Weight | 517.45 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | (4E,5R)-5-(3,4-dichlorophenyl)-1-[3-(diethylamino)propyl]-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione |
| SMILES | CCN(CC)CCCN1C(=O)C(=O)/C(=C(/O)c2ccc3c(c2)C[C@@H](C)O3)[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H30Cl2N2O4/c1-4-30(5-2)11-6-12-31-24(17-7-9-20(28)21(29)15-17)23(26(33)27(31)34)25(32)18-8-10-22-19(14-18)13-16(3)35-22/h7-10,14-16,24,32H,4-6,11-13H2,1-3H3/b25-23+/t16-,24-/m1/s1 |
| InChIKey | BSPOVRIHIHCGKY-RPUIFAKWSA-N |
| XLogP | 5.47 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|