C25H22BrN3O5 — CID 98377885
methyl 4-[(E)-[(2R)-2-(3-bromophenyl)-4,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 98377885) has the molecular formula C25H22BrN3O5 and a molecular weight of 524.37 g/mol. Its IUPAC name is methyl 4-[(E)-[(2R)-2-(3-bromophenyl)-4,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[(E)-[(2R)-2-(3-bromophenyl)-4,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 98377885 |
| Molecular Formula | C25H22BrN3O5 |
| Molecular Weight | 524.37 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | methyl 4-[(E)-[(2R)-2-(3-bromophenyl)-4,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c(C)c(/C(O)=C2\C(=O)C(=O)N(Cc3cccnc3)[C@@H]2c2cccc(Br)c2)c1C |
| InChI | InChI=1S/C25H22BrN3O5/c1-13-18(14(2)28-20(13)25(33)34-3)22(30)19-21(16-7-4-8-17(26)10-16)29(24(32)23(19)31)12-15-6-5-9-27-11-15/h4-11,21,28,30H,12H2,1-3H3/b22-19+/t21-/m1/s1 |
| InChIKey | DTFJKSUGWLEHGY-OBVHCKHUSA-N |
| XLogP | 4.20 |
| TPSA | 112.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|