C28H21ClN2O6S — CID 98379421
(4E,5S)-5-(4-chlorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(6-ethoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 98379421) has the molecular formula C28H21ClN2O6S and a molecular weight of 549.00 g/mol. Its IUPAC name is (4E,5S)-5-(4-chlorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(6-ethoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-5-(4-chlorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(6-ethoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98379421 |
| Molecular Formula | C28H21ClN2O6S |
| Molecular Weight | 549.00 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | (4E,5S)-5-(4-chlorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(6-ethoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc2nc(N3C(=O)C(=O)/C(=C(/O)c4ccc5c(c4)OCCO5)[C@@H]3c3ccc(Cl)cc3)sc2c1 |
| InChI | InChI=1S/C28H21ClN2O6S/c1-2-35-18-8-9-19-22(14-18)38-28(30-19)31-24(15-3-6-17(29)7-4-15)23(26(33)27(31)34)25(32)16-5-10-20-21(13-16)37-12-11-36-20/h3-10,13-14,24,32H,2,11-12H2,1H3/b25-23+/t24-/m0/s1 |
| InChIKey | FIVLAIXJIVHWCR-NXLSWJSLSA-N |
| XLogP | 5.75 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.00 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|