C20H19F3N2O3 — CID 98381937
2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 98381937) has the molecular formula C20H19F3N2O3 and a molecular weight of 392.38 g/mol. Its IUPAC name is 2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 98381937 |
| Molecular Formula | C20H19F3N2O3 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | CN(Cc1ccccc1C(F)(F)F)C(=O)CN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C20H19F3N2O3/c1-24(9-13-4-2-3-5-14(13)20(21,22)23)15(26)10-25-18(27)16-11-6-7-12(8-11)17(16)19(25)28/h2-7,11-12,16-17H,8-10H2,1H3/t11-,12-,16-,17+/m0/s1 |
| InChIKey | WYPCLPVOGMFFRR-MWDDYTRKSA-N |
| XLogP | 2.47 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|