C21H20Cl2N4O2S — CID 98382040
5-[(R)-(2,4-dichlorophenyl)-[(3S)-3-methylpiperidin-1-yl]methyl]-2-(furan-2-yl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol (PubChem CID 98382040) has the molecular formula C21H20Cl2N4O2S and a molecular weight of 463.39 g/mol. Its IUPAC name is 5-[(R)-(2,4-dichlorophenyl)-[(3S)-3-methylpiperidin-1-yl]methyl]-2-(furan-2-yl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol.
| Compound Name | 5-[(R)-(2,4-dichlorophenyl)-[(3S)-3-methylpiperidin-1-yl]methyl]-2-(furan-2-yl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
|---|---|
| PubChem CID | 98382040 |
| Molecular Formula | C21H20Cl2N4O2S |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 5-[(R)-(2,4-dichlorophenyl)-[(3S)-3-methylpiperidin-1-yl]methyl]-2-(furan-2-yl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
| SMILES | C[C@H]1CCCN([C@H](c2ccc(Cl)cc2Cl)c2sc3nc(-c4ccco4)nn3c2O)C1 |
| InChI | InChI=1S/C21H20Cl2N4O2S/c1-12-4-2-8-26(11-12)17(14-7-6-13(22)10-15(14)23)18-20(28)27-21(30-18)24-19(25-27)16-5-3-9-29-16/h3,5-7,9-10,12,17,28H,2,4,8,11H2,1H3/t12-,17+/m0/s1 |
| InChIKey | UHJGTBYSGKAYCJ-YVEFUNNKSA-N |
| XLogP | 5.88 |
| TPSA | 66.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |