C33H36N2O8S — CID 98382282
ethyl 2-[(2R,3E)-2-(4-butoxy-3-ethoxyphenyl)-3-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 98382282) has the molecular formula C33H36N2O8S and a molecular weight of 620.72 g/mol. Its IUPAC name is ethyl 2-[(2R,3E)-2-(4-butoxy-3-ethoxyphenyl)-3-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(2R,3E)-2-(4-butoxy-3-ethoxyphenyl)-3-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 98382282 |
| Molecular Formula | C33H36N2O8S |
| Molecular Weight | 620.72 g/mol |
| Exact Mass | 620.22 |
| IUPAC Name | ethyl 2-[(2R,3E)-2-(4-butoxy-3-ethoxyphenyl)-3-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCOc1ccc([C@@H]2/C(=C(\O)c3ccc4c(c3)C[C@H](C)O4)C(=O)C(=O)N2c2nc(C)c(C(=O)OCC)s2)cc1OCC |
| InChI | InChI=1S/C33H36N2O8S/c1-6-9-14-42-24-13-10-20(17-25(24)40-7-2)27-26(28(36)21-11-12-23-22(16-21)15-18(4)43-23)29(37)31(38)35(27)33-34-19(5)30(44-33)32(39)41-8-3/h10-13,16-18,27,36H,6-9,14-15H2,1-5H3/b28-26+/t18-,27+/m0/s1 |
| InChIKey | FQQGDAFKVHBLNE-NSOCNUKWSA-N |
| XLogP | 6.16 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.72 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|