C22H39N3O3S — CID 98384449
1-N,3-N-diethoxy-5-[(2S)-2-ethylsulfanylpropyl]-2-[(Z)-N-prop-2-enoxy-C-propylcarbonimidoyl]cyclohexane-1,3-diimine (PubChem CID 98384449) has the molecular formula C22H39N3O3S and a molecular weight of 425.64 g/mol. Its IUPAC name is 1-N,3-N-diethoxy-5-[(2S)-2-ethylsulfanylpropyl]-2-[(Z)-N-prop-2-enoxy-C-propylcarbonimidoyl]cyclohexane-1,3-diimine.
| Compound Name | 1-N,3-N-diethoxy-5-[(2S)-2-ethylsulfanylpropyl]-2-[(Z)-N-prop-2-enoxy-C-propylcarbonimidoyl]cyclohexane-1,3-diimine |
|---|---|
| PubChem CID | 98384449 |
| Molecular Formula | C22H39N3O3S |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | 1-N,3-N-diethoxy-5-[(2S)-2-ethylsulfanylpropyl]-2-[(Z)-N-prop-2-enoxy-C-propylcarbonimidoyl]cyclohexane-1,3-diimine |
| SMILES | C=CCO/N=C(/CCC)C1/C(=N\OCC)CC(C[C@H](C)SCC)C/C1=N\OCC |
| InChI | InChI=1S/C22H39N3O3S/c1-7-12-19(23-28-13-8-2)22-20(24-26-9-3)15-18(14-17(6)29-11-5)16-21(22)25-27-10-4/h8,17-18,22H,2,7,9-16H2,1,3-6H3/b23-19-,24-20-,25-21+/t17-,18?,22?/m0/s1 |
| InChIKey | MSKXSYDVWIKAML-POMOWNEESA-N |
| XLogP | 5.69 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|