C22H18Cl3NO4 — CID 98386772
(4E,5S)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(2,4-dichlorophenyl)-1-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione (PubChem CID 98386772) has the molecular formula C22H18Cl3NO4 and a molecular weight of 466.75 g/mol. Its IUPAC name is (4E,5S)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(2,4-dichlorophenyl)-1-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(2,4-dichlorophenyl)-1-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98386772 |
| Molecular Formula | C22H18Cl3NO4 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | (4E,5S)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(2,4-dichlorophenyl)-1-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(C[C@@H]2CCCO2)[C@H](c2ccc(Cl)cc2Cl)/C1=C(\O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18Cl3NO4/c23-13-5-3-12(4-6-13)20(27)18-19(16-8-7-14(24)10-17(16)25)26(22(29)21(18)28)11-15-2-1-9-30-15/h3-8,10,15,19,27H,1-2,9,11H2/b20-18+/t15-,19+/m0/s1 |
| InChIKey | FEZNWETVHAQXRK-VCJOYTQFSA-N |
| XLogP | 5.25 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|