C24H26BrClN2O4 — CID 98387337
(4E,5S)-5-(3-bromophenyl)-4-[(3-chloro-4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]pyrrolidine-2,3-dione (PubChem CID 98387337) has the molecular formula C24H26BrClN2O4 and a molecular weight of 521.84 g/mol. Its IUPAC name is (4E,5S)-5-(3-bromophenyl)-4-[(3-chloro-4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-5-(3-bromophenyl)-4-[(3-chloro-4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98387337 |
| Molecular Formula | C24H26BrClN2O4 |
| Molecular Weight | 521.84 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | (4E,5S)-5-(3-bromophenyl)-4-[(3-chloro-4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(/C(O)=C2\C(=O)C(=O)N(CCCN(C)C)[C@H]2c2cccc(Br)c2)cc1Cl |
| InChI | InChI=1S/C24H26BrClN2O4/c1-4-32-19-10-9-16(14-18(19)26)22(29)20-21(15-7-5-8-17(25)13-15)28(24(31)23(20)30)12-6-11-27(2)3/h5,7-10,13-14,21,29H,4,6,11-12H2,1-3H3/b22-20+/t21-/m0/s1 |
| InChIKey | FCNPSIPUGBQHDR-MRJHHRETSA-N |
| XLogP | 4.87 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.84 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|