C13H13NO5 — CID 98387634
[(3aS,4R,7R,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl] 3-methylbut-2-enoate (PubChem CID 98387634) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is [(3aS,4R,7R,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl] 3-methylbut-2-enoate.
| Compound Name | [(3aS,4R,7R,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 98387634 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | [(3aS,4R,7R,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)ON1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2O1 |
| InChI | InChI=1S/C13H13NO5/c1-6(2)5-9(15)19-14-12(16)10-7-3-4-8(18-7)11(10)13(14)17/h3-5,7-8,10-11H,1-2H3/t7-,8-,10-,11+/m1/s1 |
| InChIKey | GZWDTRFQWGOSEP-OYBPUVFXSA-N |
| XLogP | 0.35 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|