C25H30N4O3S — CID 98389458
[(E)-[(3S,4S)-4-(4-hydroxy-2H-chromen-3-yl)-3-(morpholin-4-ylmethyl)-4-phenylbutan-2-ylidene]amino]thiourea (PubChem CID 98389458) has the molecular formula C25H30N4O3S and a molecular weight of 466.61 g/mol. Its IUPAC name is [(E)-[(3S,4S)-4-(4-hydroxy-2H-chromen-3-yl)-3-(morpholin-4-ylmethyl)-4-phenylbutan-2-ylidene]amino]thiourea.
| Compound Name | [(E)-[(3S,4S)-4-(4-hydroxy-2H-chromen-3-yl)-3-(morpholin-4-ylmethyl)-4-phenylbutan-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 98389458 |
| Molecular Formula | C25H30N4O3S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | [(E)-[(3S,4S)-4-(4-hydroxy-2H-chromen-3-yl)-3-(morpholin-4-ylmethyl)-4-phenylbutan-2-ylidene]amino]thiourea |
| SMILES | C/C(=N\NC(N)=S)[C@H](CN1CCOCC1)[C@H](C1=C(O)c2ccccc2OC1)c1ccccc1 |
| InChI | InChI=1S/C25H30N4O3S/c1-17(27-28-25(26)33)20(15-29-11-13-31-14-12-29)23(18-7-3-2-4-8-18)21-16-32-22-10-6-5-9-19(22)24(21)30/h2-10,20,23,30H,11-16H2,1H3,(H3,26,28,33)/b27-17+/t20-,23+/m0/s1 |
| InChIKey | QSKCLVDZQVNOJR-BWYYGQEYSA-N |
| XLogP | 3.29 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|